C17H28N4O8 — CID 73472651
tert-butyl N-[2-[[3-hydroxyimino-2-methyl-4-[(5-nitrofuran-2-yl)methoxy]butan-2-yl]amino]oxyethyl]carbamate (PubChem CID 73472651) has the molecular formula C17H28N4O8 and a molecular weight of 416.43 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-hydroxyimino-2-methyl-4-[(5-nitrofuran-2-yl)methoxy]butan-2-yl]amino]oxyethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3-hydroxyimino-2-methyl-4-[(5-nitrofuran-2-yl)methoxy]butan-2-yl]amino]oxyethyl]carbamate |
|---|---|
| PubChem CID | 73472651 |
| Molecular Formula | C17H28N4O8 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | tert-butyl N-[2-[[3-hydroxyimino-2-methyl-4-[(5-nitrofuran-2-yl)methoxy]butan-2-yl]amino]oxyethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCONC(C)(C)C(COCc1ccc([N+](=O)[O-])o1)=NO |
| InChI | InChI=1S/C17H28N4O8/c1-16(2,3)29-15(22)18-8-9-27-20-17(4,5)13(19-23)11-26-10-12-6-7-14(28-12)21(24)25/h6-7,20,23H,8-11H2,1-5H3,(H,18,22) |
| InChIKey | MCVOIXJVIVGKFH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 157.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|