C15H19NO4 — CID 18930299
[4-(1,2-dioxa-8-azaspiro[4.5]decan-8-yl)phenyl]methyl formate (PubChem CID 18930299) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is [4-(1,2-dioxa-8-azaspiro[4.5]decan-8-yl)phenyl]methyl formate.
| Compound Name | [4-(1,2-dioxa-8-azaspiro[4.5]decan-8-yl)phenyl]methyl formate |
|---|---|
| PubChem CID | 18930299 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | [4-(1,2-dioxa-8-azaspiro[4.5]decan-8-yl)phenyl]methyl formate |
| SMILES | O=COCc1ccc(N2CCC3(CCOO3)CC2)cc1 |
| InChI | InChI=1S/C15H19NO4/c17-12-18-11-13-1-3-14(4-2-13)16-8-5-15(6-9-16)7-10-19-20-15/h1-4,12H,5-11H2 |
| InChIKey | NKSWTPFNSIZRTQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|