C23H22BrClN2 — CID 18933149
8-bromo-7-methyl-1-(naphthalen-1-ylmethyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride (PubChem CID 18933149) has the molecular formula C23H22BrClN2 and a molecular weight of 441.80 g/mol. Its IUPAC name is 8-bromo-7-methyl-1-(naphthalen-1-ylmethyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride.
| Compound Name | 8-bromo-7-methyl-1-(naphthalen-1-ylmethyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride |
|---|---|
| PubChem CID | 18933149 |
| Molecular Formula | C23H22BrClN2 |
| Molecular Weight | 441.80 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | 8-bromo-7-methyl-1-(naphthalen-1-ylmethyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride |
| SMILES | Cc1ccc2c3c([nH]c2c1Br)C(Cc1cccc2ccccc12)NCC3.Cl |
| InChI | InChI=1S/C23H21BrN2.ClH/c1-14-9-10-18-19-11-12-25-20(22(19)26-23(18)21(14)24)13-16-7-4-6-15-5-2-3-8-17(15)16;/h2-10,20,25-26H,11-13H2,1H3;1H |
| InChIKey | JEGAIGVWPUUFMM-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.80 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|