C21H24BrClN2O2 — CID 18702244
8-bromo-1-[(3,4-dimethoxyphenyl)methyl]-7-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride (PubChem CID 18702244) has the molecular formula C21H24BrClN2O2 and a molecular weight of 451.79 g/mol. Its IUPAC name is 8-bromo-1-[(3,4-dimethoxyphenyl)methyl]-7-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride.
| Compound Name | 8-bromo-1-[(3,4-dimethoxyphenyl)methyl]-7-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride |
|---|---|
| PubChem CID | 18702244 |
| Molecular Formula | C21H24BrClN2O2 |
| Molecular Weight | 451.79 g/mol |
| Exact Mass | 450.07 |
| IUPAC Name | 8-bromo-1-[(3,4-dimethoxyphenyl)methyl]-7-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride |
| SMILES | COc1ccc(CC2NCCc3c2[nH]c2c(Br)c(C)ccc32)cc1OC.Cl |
| InChI | InChI=1S/C21H23BrN2O2.ClH/c1-12-4-6-14-15-8-9-23-16(20(15)24-21(14)19(12)22)10-13-5-7-17(25-2)18(11-13)26-3;/h4-7,11,16,23-24H,8-10H2,1-3H3;1H |
| InChIKey | CTKJGXKUWQMBMX-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.79 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|