C21H25ClN2O — CID 161157060
1-[(3-methoxy-4-methylphenyl)methyl]-6-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride (PubChem CID 161157060) has the molecular formula C21H25ClN2O and a molecular weight of 356.90 g/mol. Its IUPAC name is 1-[(3-methoxy-4-methylphenyl)methyl]-6-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride.
| Compound Name | 1-[(3-methoxy-4-methylphenyl)methyl]-6-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride |
|---|---|
| PubChem CID | 161157060 |
| Molecular Formula | C21H25ClN2O |
| Molecular Weight | 356.90 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 1-[(3-methoxy-4-methylphenyl)methyl]-6-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride |
| SMILES | COc1cc(CC2NCCc3c2[nH]c2ccc(C)cc32)ccc1C.Cl |
| InChI | InChI=1S/C21H24N2O.ClH/c1-13-4-7-18-17(10-13)16-8-9-22-19(21(16)23-18)11-15-6-5-14(2)20(12-15)24-3;/h4-7,10,12,19,22-23H,8-9,11H2,1-3H3;1H |
| InChIKey | YQJMEXBESAQRDN-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.90 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|