About 2,2-difluoroethanethiol
2,2-difluoroethanethiol (PubChem CID 18934465) has the molecular formula C2H4F2S
and a molecular weight of 98.12 g/mol. Its IUPAC name is 2,2-difluoroethanethiol.
Molecular Properties
| Compound Name | 2,2-difluoroethanethiol |
| PubChem CID | 18934465 |
| Molecular Formula | C2H4F2S |
| Molecular Weight | 98.12 g/mol |
| Exact Mass | 98.00 |
| IUPAC Name | 2,2-difluoroethanethiol |
| SMILES | FC(F)CS |
| InChI | InChI=1S/C2H4F2S/c3-2(4)1-5/h2,5H,1H2 |
| InChIKey | IPTRDMXWNOXEOK-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.12 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2,2-difluoroethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-difluoroethanethiol?
The IUPAC name of 2,2-difluoroethanethiol (CID 18934465) is 2,2-difluoroethanethiol.
What is the SMILES notation for 2,2-difluoroethanethiol?
The canonical SMILES for 2,2-difluoroethanethiol is FC(F)CS.
What is the InChIKey of 2,2-difluoroethanethiol?
The InChIKey is IPTRDMXWNOXEOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4F2S/c3-2(4)1-5/h2,5H,1H2.
What are the key properties of 2,2-difluoroethanethiol?
2,2-difluoroethanethiol has a molecular weight of 98.12 g/mol, XLogP of 1.18, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoroethanethiol is sourced from PubChem (CID 18934465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).