About 1-chloro-2-methoxy-4-(methoxymethyl)benzene;diethoxy(oxo)phosphanium
1-chloro-2-methoxy-4-(methoxymethyl)benzene;diethoxy(oxo)phosphanium (PubChem CID 18938168) has the molecular formula C13H21ClO5P+
and a molecular weight of 323.73 g/mol. Its IUPAC name is 1-chloro-2-methoxy-4-(methoxymethyl)benzene;diethoxy(oxo)phosphanium.
Molecular Properties
| Compound Name | 1-chloro-2-methoxy-4-(methoxymethyl)benzene;diethoxy(oxo)phosphanium |
| PubChem CID | 18938168 |
| Molecular Formula | C13H21ClO5P+ |
| Molecular Weight | 323.73 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 1-chloro-2-methoxy-4-(methoxymethyl)benzene;diethoxy(oxo)phosphanium |
| SMILES | CCO[P+](=O)OCC.COCc1ccc(Cl)c(OC)c1 |
| InChI | InChI=1S/C9H11ClO2.C4H10O3P/c1-11-6-7-3-4-8(10)9(5-7)12-2;1-3-6-8(5)7-4-2/h3-5H,6H2,1-2H3;3-4H2,1-2H3/q;+1 |
| InChIKey | QHZMWUMTPMBCNN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.73 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-2-methoxy-4-(methoxymethyl)benzene;diethoxy(oxo)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-2-methoxy-4-(methoxymethyl)benzene;diethoxy(oxo)phosphanium?
The IUPAC name of 1-chloro-2-methoxy-4-(methoxymethyl)benzene;diethoxy(oxo)phosphanium (CID 18938168) is 1-chloro-2-methoxy-4-(methoxymethyl)benzene;diethoxy(oxo)phosphanium.
What is the SMILES notation for 1-chloro-2-methoxy-4-(methoxymethyl)benzene;diethoxy(oxo)phosphanium?
The canonical SMILES for 1-chloro-2-methoxy-4-(methoxymethyl)benzene;diethoxy(oxo)phosphanium is CCO[P+](=O)OCC.COCc1ccc(Cl)c(OC)c1.
What is the InChIKey of 1-chloro-2-methoxy-4-(methoxymethyl)benzene;diethoxy(oxo)phosphanium?
The InChIKey is QHZMWUMTPMBCNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClO2.C4H10O3P/c1-11-6-7-3-4-8(10)9(5-7)12-2;1-3-6-8(5)7-4-2/h3-5H,6H2,1-2H3;3-4H2,1-2H3/q;+1.
What are the key properties of 1-chloro-2-methoxy-4-(methoxymethyl)benzene;diethoxy(oxo)phosphanium?
1-chloro-2-methoxy-4-(methoxymethyl)benzene;diethoxy(oxo)phosphanium has a molecular weight of 323.73 g/mol, XLogP of 4.21, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-2-methoxy-4-(methoxymethyl)benzene;diethoxy(oxo)phosphanium is sourced from PubChem (CID 18938168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).