C16H22O8 — CID 18939211
(7-ethoxycarbonylperoxy-2,7-dimethylocta-3,5-diyn-2-yl)oxy ethyl carbonate (PubChem CID 18939211) has the molecular formula C16H22O8 and a molecular weight of 342.34 g/mol. Its IUPAC name is (7-ethoxycarbonylperoxy-2,7-dimethylocta-3,5-diyn-2-yl)oxy ethyl carbonate.
| Compound Name | (7-ethoxycarbonylperoxy-2,7-dimethylocta-3,5-diyn-2-yl)oxy ethyl carbonate |
|---|---|
| PubChem CID | 18939211 |
| Molecular Formula | C16H22O8 |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | (7-ethoxycarbonylperoxy-2,7-dimethylocta-3,5-diyn-2-yl)oxy ethyl carbonate |
| SMILES | CCOC(=O)OOC(C)(C)C#CC#CC(C)(C)OOC(=O)OCC |
| InChI | InChI=1S/C16H22O8/c1-7-19-13(17)21-23-15(3,4)11-9-10-12-16(5,6)24-22-14(18)20-8-2/h7-8H2,1-6H3 |
| InChIKey | QZMVWXJQTANPHY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|