C13H22O7 — CID 88526777
(2-ethoxycarbonylperoxy-3,3-dimethylpentan-2-yl) prop-2-eneperoxoate (PubChem CID 88526777) has the molecular formula C13H22O7 and a molecular weight of 290.31 g/mol. Its IUPAC name is (2-ethoxycarbonylperoxy-3,3-dimethylpentan-2-yl) prop-2-eneperoxoate.
| Compound Name | (2-ethoxycarbonylperoxy-3,3-dimethylpentan-2-yl) prop-2-eneperoxoate |
|---|---|
| PubChem CID | 88526777 |
| Molecular Formula | C13H22O7 |
| Molecular Weight | 290.31 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | (2-ethoxycarbonylperoxy-3,3-dimethylpentan-2-yl) prop-2-eneperoxoate |
| SMILES | C=CC(=O)OOC(C)(OOC(=O)OCC)C(C)(C)CC |
| InChI | InChI=1S/C13H22O7/c1-7-10(14)17-19-13(6,12(4,5)8-2)20-18-11(15)16-9-3/h7H,1,8-9H2,2-6H3 |
| InChIKey | FHHKUTHAVBLEKE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|