C20H28O6 — CID 18942603
ethyl 2-[[1-(2-ethoxycarbonylprop-2-enyl)-4,4-dimethyl-2,6-dioxocyclohexyl]methyl]prop-2-enoate (PubChem CID 18942603) has the molecular formula C20H28O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is ethyl 2-[[1-(2-ethoxycarbonylprop-2-enyl)-4,4-dimethyl-2,6-dioxocyclohexyl]methyl]prop-2-enoate.
| Compound Name | ethyl 2-[[1-(2-ethoxycarbonylprop-2-enyl)-4,4-dimethyl-2,6-dioxocyclohexyl]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 18942603 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | ethyl 2-[[1-(2-ethoxycarbonylprop-2-enyl)-4,4-dimethyl-2,6-dioxocyclohexyl]methyl]prop-2-enoate |
| SMILES | C=C(CC1(CC(=C)C(=O)OCC)C(=O)CC(C)(C)CC1=O)C(=O)OCC |
| InChI | InChI=1S/C20H28O6/c1-7-25-17(23)13(3)9-20(10-14(4)18(24)26-8-2)15(21)11-19(5,6)12-16(20)22/h3-4,7-12H2,1-2,5-6H3 |
| InChIKey | ASGZKUGORXUHCB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|