2-formyl-3,4-dihydropyran-2-carboxylic acid

C7H8O4 — CID 18955221

IUPAC2-formyl-3,4-dihydropyran-2-carboxylic acid
SMILESO=CC1(C(=O)O)CCC=CO1
InChIInChI=1S/C7H8O4/c8-5-7(6(9)10)3-1-2-4-11-7/h2,4-5H,1,3H2,(H,9,10)
InChIKeyBTLTYOKSJYHFAK-UHFFFAOYSA-N
MW156.14 g/mol
LogP0.33
Rot. Bonds2

About 2-formyl-3,4-dihydropyran-2-carboxylic acid

2-formyl-3,4-dihydropyran-2-carboxylic acid (PubChem CID 18955221) has the molecular formula C7H8O4 and a molecular weight of 156.14 g/mol. Its IUPAC name is 2-formyl-3,4-dihydropyran-2-carboxylic acid.

Molecular Properties

Compound Name2-formyl-3,4-dihydropyran-2-carboxylic acid
PubChem CID18955221
Molecular FormulaC7H8O4
Molecular Weight156.14 g/mol
Exact Mass156.04
IUPAC Name2-formyl-3,4-dihydropyran-2-carboxylic acid
SMILESO=CC1(C(=O)O)CCC=CO1
InChIInChI=1S/C7H8O4/c8-5-7(6(9)10)3-1-2-4-11-7/h2,4-5H,1,3H2,(H,9,10)
InChIKeyBTLTYOKSJYHFAK-UHFFFAOYSA-N
XLogP0.33
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500156.14
LogP ≤ 50.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 2-formyl-3,4-dihydropyran-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-formyl-3,4-dihydropyran-2-carboxylic acid?
The IUPAC name of 2-formyl-3,4-dihydropyran-2-carboxylic acid (CID 18955221) is 2-formyl-3,4-dihydropyran-2-carboxylic acid.
What is the SMILES notation for 2-formyl-3,4-dihydropyran-2-carboxylic acid?
The canonical SMILES for 2-formyl-3,4-dihydropyran-2-carboxylic acid is O=CC1(C(=O)O)CCC=CO1.
What is the InChIKey of 2-formyl-3,4-dihydropyran-2-carboxylic acid?
The InChIKey is BTLTYOKSJYHFAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O4/c8-5-7(6(9)10)3-1-2-4-11-7/h2,4-5H,1,3H2,(H,9,10).
What are the key properties of 2-formyl-3,4-dihydropyran-2-carboxylic acid?
2-formyl-3,4-dihydropyran-2-carboxylic acid has a molecular weight of 156.14 g/mol, XLogP of 0.33, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-formyl-3,4-dihydropyran-2-carboxylic acid is sourced from PubChem (CID 18955221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).