C11H16O3 — CID 54477396
(2-methyl-3,4-dihydropyran-2-yl)methyl but-2-enoate (PubChem CID 54477396) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is (2-methyl-3,4-dihydropyran-2-yl)methyl but-2-enoate.
| Compound Name | (2-methyl-3,4-dihydropyran-2-yl)methyl but-2-enoate |
|---|---|
| PubChem CID | 54477396 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | (2-methyl-3,4-dihydropyran-2-yl)methyl but-2-enoate |
| SMILES | CC=CC(=O)OCC1(C)CCC=CO1 |
| InChI | InChI=1S/C11H16O3/c1-3-6-10(12)13-9-11(2)7-4-5-8-14-11/h3,5-6,8H,4,7,9H2,1-2H3 |
| InChIKey | XMOCBSKRSXDCBA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|