About (2,3-dimethyloxiran-2-yl) but-2-enoate
(2,3-dimethyloxiran-2-yl) but-2-enoate (PubChem CID 174640587) has the molecular formula C8H12O3
and a molecular weight of 156.18 g/mol. Its IUPAC name is (2,3-dimethyloxiran-2-yl) but-2-enoate.
Molecular Properties
| Compound Name | (2,3-dimethyloxiran-2-yl) but-2-enoate |
| PubChem CID | 174640587 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | (2,3-dimethyloxiran-2-yl) but-2-enoate |
| SMILES | CC=CC(=O)OC1(C)OC1C |
| InChI | InChI=1S/C8H12O3/c1-4-5-7(9)11-8(3)6(2)10-8/h4-6H,1-3H3 |
| InChIKey | OYMKPPLRODTLSU-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2,3-dimethyloxiran-2-yl) but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-dimethyloxiran-2-yl) but-2-enoate?
The IUPAC name of (2,3-dimethyloxiran-2-yl) but-2-enoate (CID 174640587) is (2,3-dimethyloxiran-2-yl) but-2-enoate.
What is the SMILES notation for (2,3-dimethyloxiran-2-yl) but-2-enoate?
The canonical SMILES for (2,3-dimethyloxiran-2-yl) but-2-enoate is CC=CC(=O)OC1(C)OC1C.
What is the InChIKey of (2,3-dimethyloxiran-2-yl) but-2-enoate?
The InChIKey is OYMKPPLRODTLSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O3/c1-4-5-7(9)11-8(3)6(2)10-8/h4-6H,1-3H3.
What are the key properties of (2,3-dimethyloxiran-2-yl) but-2-enoate?
(2,3-dimethyloxiran-2-yl) but-2-enoate has a molecular weight of 156.18 g/mol, XLogP of 1.24, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dimethyloxiran-2-yl) but-2-enoate is sourced from PubChem (CID 174640587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).