C9H11F3O3 — CID 151427211
[2,3-dimethyl-3-(trifluoromethyl)oxiran-2-yl] but-2-enoate (PubChem CID 151427211) has the molecular formula C9H11F3O3 and a molecular weight of 224.18 g/mol. Its IUPAC name is [2,3-dimethyl-3-(trifluoromethyl)oxiran-2-yl] but-2-enoate.
| Compound Name | [2,3-dimethyl-3-(trifluoromethyl)oxiran-2-yl] but-2-enoate |
|---|---|
| PubChem CID | 151427211 |
| Molecular Formula | C9H11F3O3 |
| Molecular Weight | 224.18 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | [2,3-dimethyl-3-(trifluoromethyl)oxiran-2-yl] but-2-enoate |
| SMILES | CC=CC(=O)OC1(C)OC1(C)C(F)(F)F |
| InChI | InChI=1S/C9H11F3O3/c1-4-5-6(13)14-8(3)7(2,15-8)9(10,11)12/h4-5H,1-3H3 |
| InChIKey | PBTOLINPDLTCQM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.18 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|