C10H15NO4 — CID 142627159
4-[(E)-but-2-enoyl]-2,2-dimethyl-1,3-oxazolidine-5-carboxylic acid (PubChem CID 142627159) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is 4-[(E)-but-2-enoyl]-2,2-dimethyl-1,3-oxazolidine-5-carboxylic acid.
| Compound Name | 4-[(E)-but-2-enoyl]-2,2-dimethyl-1,3-oxazolidine-5-carboxylic acid |
|---|---|
| PubChem CID | 142627159 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 4-[(E)-but-2-enoyl]-2,2-dimethyl-1,3-oxazolidine-5-carboxylic acid |
| SMILES | C/C=C/C(=O)C1NC(C)(C)OC1C(=O)O |
| InChI | InChI=1S/C10H15NO4/c1-4-5-6(12)7-8(9(13)14)15-10(2,3)11-7/h4-5,7-8,11H,1-3H3,(H,13,14)/b5-4+ |
| InChIKey | XRHDQOPQGULOMV-SNAWJCMRSA-N |
| XLogP | 0.31 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|