C23H20FN3O3S — CID 18956572
1-[1-[4-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-fluorophenyl]ethyl]-1-hydroxyurea (PubChem CID 18956572) has the molecular formula C23H20FN3O3S and a molecular weight of 437.50 g/mol. Its IUPAC name is 1-[1-[4-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-fluorophenyl]ethyl]-1-hydroxyurea.
| Compound Name | 1-[1-[4-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-fluorophenyl]ethyl]-1-hydroxyurea |
|---|---|
| PubChem CID | 18956572 |
| Molecular Formula | C23H20FN3O3S |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 1-[1-[4-[4-(1,3-benzothiazol-2-ylmethoxy)phenyl]-3-fluorophenyl]ethyl]-1-hydroxyurea |
| SMILES | CC(c1ccc(-c2ccc(OCc3nc4ccccc4s3)cc2)c(F)c1)N(O)C(N)=O |
| InChI | InChI=1S/C23H20FN3O3S/c1-14(27(29)23(25)28)16-8-11-18(19(24)12-16)15-6-9-17(10-7-15)30-13-22-26-20-4-2-3-5-21(20)31-22/h2-12,14,29H,13H2,1H3,(H2,25,28) |
| InChIKey | OSOASUNVXFZWMD-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 88.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|