C17H21N5O — CID 18957750
1-[(5-methyl-1H-imidazol-4-yl)methyl]-4-(2-methyl-2-phenylhydrazinyl)-2,3-dihydropyridin-6-one (PubChem CID 18957750) has the molecular formula C17H21N5O and a molecular weight of 311.39 g/mol. Its IUPAC name is 1-[(5-methyl-1H-imidazol-4-yl)methyl]-4-(2-methyl-2-phenylhydrazinyl)-2,3-dihydropyridin-6-one.
| Compound Name | 1-[(5-methyl-1H-imidazol-4-yl)methyl]-4-(2-methyl-2-phenylhydrazinyl)-2,3-dihydropyridin-6-one |
|---|---|
| PubChem CID | 18957750 |
| Molecular Formula | C17H21N5O |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 1-[(5-methyl-1H-imidazol-4-yl)methyl]-4-(2-methyl-2-phenylhydrazinyl)-2,3-dihydropyridin-6-one |
| SMILES | Cc1[nH]cnc1CN1CCC(NN(C)c2ccccc2)=CC1=O |
| InChI | InChI=1S/C17H21N5O/c1-13-16(19-12-18-13)11-22-9-8-14(10-17(22)23)20-21(2)15-6-4-3-5-7-15/h3-7,10,12,20H,8-9,11H2,1-2H3,(H,18,19) |
| InChIKey | PBEUMTWYLAGXEX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|