About [4-[2-[4-[2-[4-(2-fluorobutanoyloxy)cyclohexyl]ethyl]phenyl]ethyl]cyclohexyl] 2-fluorobutanoate
[4-[2-[4-[2-[4-(2-fluorobutanoyloxy)cyclohexyl]ethyl]phenyl]ethyl]cyclohexyl] 2-fluorobutanoate (PubChem CID 18960157) has the molecular formula C30H44F2O4
and a molecular weight of 506.67 g/mol. Its IUPAC name is [4-[2-[4-[2-[4-(2-fluorobutanoyloxy)cyclohexyl]ethyl]phenyl]ethyl]cyclohexyl] 2-fluorobutanoate.
Molecular Properties
| Compound Name | [4-[2-[4-[2-[4-(2-fluorobutanoyloxy)cyclohexyl]ethyl]phenyl]ethyl]cyclohexyl] 2-fluorobutanoate |
| PubChem CID | 18960157 |
| Molecular Formula | C30H44F2O4 |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.32 |
| IUPAC Name | [4-[2-[4-[2-[4-(2-fluorobutanoyloxy)cyclohexyl]ethyl]phenyl]ethyl]cyclohexyl] 2-fluorobutanoate |
| SMILES | CCC(F)C(=O)OC1CCC(CCc2ccc(CCC3CCC(OC(=O)C(F)CC)CC3)cc2)CC1 |
| InChI | InChI=1S/C30H44F2O4/c1-3-27(31)29(33)35-25-17-13-23(14-18-25)11-9-21-5-7-22(8-6-21)10-12-24-15-19-26(20-16-24)36-30(34)28(32)4-2/h5-8,23-28H,3-4,9-20H2,1-2H3 |
| InChIKey | QSJWACXLJISHHW-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[2-[4-[2-[4-(2-fluorobutanoyloxy)cyclohexyl]ethyl]phenyl]ethyl]cyclohexyl] 2-fluorobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-[4-[2-[4-(2-fluorobutanoyloxy)cyclohexyl]ethyl]phenyl]ethyl]cyclohexyl] 2-fluorobutanoate?
The IUPAC name of [4-[2-[4-[2-[4-(2-fluorobutanoyloxy)cyclohexyl]ethyl]phenyl]ethyl]cyclohexyl] 2-fluorobutanoate (CID 18960157) is [4-[2-[4-[2-[4-(2-fluorobutanoyloxy)cyclohexyl]ethyl]phenyl]ethyl]cyclohexyl] 2-fluorobutanoate.
What is the SMILES notation for [4-[2-[4-[2-[4-(2-fluorobutanoyloxy)cyclohexyl]ethyl]phenyl]ethyl]cyclohexyl] 2-fluorobutanoate?
The canonical SMILES for [4-[2-[4-[2-[4-(2-fluorobutanoyloxy)cyclohexyl]ethyl]phenyl]ethyl]cyclohexyl] 2-fluorobutanoate is CCC(F)C(=O)OC1CCC(CCc2ccc(CCC3CCC(OC(=O)C(F)CC)CC3)cc2)CC1.
What is the InChIKey of [4-[2-[4-[2-[4-(2-fluorobutanoyloxy)cyclohexyl]ethyl]phenyl]ethyl]cyclohexyl] 2-fluorobutanoate?
The InChIKey is QSJWACXLJISHHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H44F2O4/c1-3-27(31)29(33)35-25-17-13-23(14-18-25)11-9-21-5-7-22(8-6-21)10-12-24-15-19-26(20-16-24)36-30(34)28(32)4-2/h5-8,23-28H,3-4,9-20H2,1-2H3.
What are the key properties of [4-[2-[4-[2-[4-(2-fluorobutanoyloxy)cyclohexyl]ethyl]phenyl]ethyl]cyclohexyl] 2-fluorobutanoate?
[4-[2-[4-[2-[4-(2-fluorobutanoyloxy)cyclohexyl]ethyl]phenyl]ethyl]cyclohexyl] 2-fluorobutanoate has a molecular weight of 506.67 g/mol, XLogP of 7.25, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-[4-[2-[4-(2-fluorobutanoyloxy)cyclohexyl]ethyl]phenyl]ethyl]cyclohexyl] 2-fluorobutanoate is sourced from PubChem (CID 18960157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).