C7H16N2O4 — CID 18962124
1,1,3-tris(methoxymethyl)urea (PubChem CID 18962124) has the molecular formula C7H16N2O4 and a molecular weight of 192.21 g/mol. Its IUPAC name is 1,1,3-tris(methoxymethyl)urea.
| Compound Name | 1,1,3-tris(methoxymethyl)urea |
|---|---|
| PubChem CID | 18962124 |
| Molecular Formula | C7H16N2O4 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.11 |
| IUPAC Name | 1,1,3-tris(methoxymethyl)urea |
| SMILES | COCNC(=O)N(COC)COC |
| InChI | InChI=1S/C7H16N2O4/c1-11-4-8-7(10)9(5-12-2)6-13-3/h4-6H2,1-3H3,(H,8,10) |
| InChIKey | IVHGQRJQXVQZIL-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|