C16H34N2O4 — CID 89402141
1,1,3-tris(butoxymethyl)urea (PubChem CID 89402141) has the molecular formula C16H34N2O4 and a molecular weight of 318.46 g/mol. Its IUPAC name is 1,1,3-tris(butoxymethyl)urea.
| Compound Name | 1,1,3-tris(butoxymethyl)urea |
|---|---|
| PubChem CID | 89402141 |
| Molecular Formula | C16H34N2O4 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.25 |
| IUPAC Name | 1,1,3-tris(butoxymethyl)urea |
| SMILES | CCCCOCNC(=O)N(COCCCC)COCCCC |
| InChI | InChI=1S/C16H34N2O4/c1-4-7-10-20-13-17-16(19)18(14-21-11-8-5-2)15-22-12-9-6-3/h4-15H2,1-3H3,(H,17,19) |
| InChIKey | WRZZRELCLYNEPZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|