C28H44INO3S — CID 18962236
benzenesulfonate;1-(3-iodoprop-2-ynyl)-1-tetradecyl-3,6-dihydro-2H-pyridin-1-ium (PubChem CID 18962236) has the molecular formula C28H44INO3S and a molecular weight of 601.64 g/mol. Its IUPAC name is benzenesulfonate;1-(3-iodoprop-2-ynyl)-1-tetradecyl-3,6-dihydro-2H-pyridin-1-ium.
| Compound Name | benzenesulfonate;1-(3-iodoprop-2-ynyl)-1-tetradecyl-3,6-dihydro-2H-pyridin-1-ium |
|---|---|
| PubChem CID | 18962236 |
| Molecular Formula | C28H44INO3S |
| Molecular Weight | 601.64 g/mol |
| Exact Mass | 601.21 |
| IUPAC Name | benzenesulfonate;1-(3-iodoprop-2-ynyl)-1-tetradecyl-3,6-dihydro-2H-pyridin-1-ium |
| SMILES | CCCCCCCCCCCCCC[N+]1(CC#CI)CC=CCC1.O=S(=O)([O-])c1ccccc1 |
| InChI | InChI=1S/C22H39IN.C6H6O3S/c1-2-3-4-5-6-7-8-9-10-11-12-14-19-24(22-17-18-23)20-15-13-16-21-24;7-10(8,9)6-4-2-1-3-5-6/h13,15H,2-12,14,16,19-22H2,1H3;1-5H,(H,7,8,9)/q+1;/p-1 |
| InChIKey | WHKPTMDSZODDSV-UHFFFAOYSA-M |
| XLogP | 7.45 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.64 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|