About 3-methylbut-2-enyl N-[2-(4-benzyl-2-chlorophenoxy)ethyl]carbamate
3-methylbut-2-enyl N-[2-(4-benzyl-2-chlorophenoxy)ethyl]carbamate (PubChem CID 18966607) has the molecular formula C21H24ClNO3
and a molecular weight of 373.88 g/mol. Its IUPAC name is 3-methylbut-2-enyl N-[2-(4-benzyl-2-chlorophenoxy)ethyl]carbamate.
Molecular Properties
| Compound Name | 3-methylbut-2-enyl N-[2-(4-benzyl-2-chlorophenoxy)ethyl]carbamate |
| PubChem CID | 18966607 |
| Molecular Formula | C21H24ClNO3 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 3-methylbut-2-enyl N-[2-(4-benzyl-2-chlorophenoxy)ethyl]carbamate |
| SMILES | CC(C)=CCOC(=O)NCCOc1ccc(Cc2ccccc2)cc1Cl |
| InChI | InChI=1S/C21H24ClNO3/c1-16(2)10-12-26-21(24)23-11-13-25-20-9-8-18(15-19(20)22)14-17-6-4-3-5-7-17/h3-10,15H,11-14H2,1-2H3,(H,23,24) |
| InChIKey | AFLNEJHMMGIRIA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbut-2-enyl N-[2-(4-benzyl-2-chlorophenoxy)ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbut-2-enyl N-[2-(4-benzyl-2-chlorophenoxy)ethyl]carbamate?
The IUPAC name of 3-methylbut-2-enyl N-[2-(4-benzyl-2-chlorophenoxy)ethyl]carbamate (CID 18966607) is 3-methylbut-2-enyl N-[2-(4-benzyl-2-chlorophenoxy)ethyl]carbamate.
What is the SMILES notation for 3-methylbut-2-enyl N-[2-(4-benzyl-2-chlorophenoxy)ethyl]carbamate?
The canonical SMILES for 3-methylbut-2-enyl N-[2-(4-benzyl-2-chlorophenoxy)ethyl]carbamate is CC(C)=CCOC(=O)NCCOc1ccc(Cc2ccccc2)cc1Cl.
What is the InChIKey of 3-methylbut-2-enyl N-[2-(4-benzyl-2-chlorophenoxy)ethyl]carbamate?
The InChIKey is AFLNEJHMMGIRIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24ClNO3/c1-16(2)10-12-26-21(24)23-11-13-25-20-9-8-18(15-19(20)22)14-17-6-4-3-5-7-17/h3-10,15H,11-14H2,1-2H3,(H,23,24).
What are the key properties of 3-methylbut-2-enyl N-[2-(4-benzyl-2-chlorophenoxy)ethyl]carbamate?
3-methylbut-2-enyl N-[2-(4-benzyl-2-chlorophenoxy)ethyl]carbamate has a molecular weight of 373.88 g/mol, XLogP of 5.00, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbut-2-enyl N-[2-(4-benzyl-2-chlorophenoxy)ethyl]carbamate is sourced from PubChem (CID 18966607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).