C20H21ClF3NO3 — CID 67786358
2-(4-benzyl-2-chlorophenoxy)ethyl-(4,4,4-trifluorobutyl)carbamic acid (PubChem CID 67786358) has the molecular formula C20H21ClF3NO3 and a molecular weight of 415.84 g/mol. Its IUPAC name is 2-(4-benzyl-2-chlorophenoxy)ethyl-(4,4,4-trifluorobutyl)carbamic acid.
| Compound Name | 2-(4-benzyl-2-chlorophenoxy)ethyl-(4,4,4-trifluorobutyl)carbamic acid |
|---|---|
| PubChem CID | 67786358 |
| Molecular Formula | C20H21ClF3NO3 |
| Molecular Weight | 415.84 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 2-(4-benzyl-2-chlorophenoxy)ethyl-(4,4,4-trifluorobutyl)carbamic acid |
| SMILES | O=C(O)N(CCCC(F)(F)F)CCOc1ccc(Cc2ccccc2)cc1Cl |
| InChI | InChI=1S/C20H21ClF3NO3/c21-17-14-16(13-15-5-2-1-3-6-15)7-8-18(17)28-12-11-25(19(26)27)10-4-9-20(22,23)24/h1-3,5-8,14H,4,9-13H2,(H,26,27) |
| InChIKey | HXOTVHYBLZNTKP-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.84 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |