C21H22ClNO3 — CID 54506520
2-methylbut-3-yn-2-yl N-[2-(4-benzyl-2-chlorophenoxy)ethyl]carbamate (PubChem CID 54506520) has the molecular formula C21H22ClNO3 and a molecular weight of 371.86 g/mol. Its IUPAC name is 2-methylbut-3-yn-2-yl N-[2-(4-benzyl-2-chlorophenoxy)ethyl]carbamate.
| Compound Name | 2-methylbut-3-yn-2-yl N-[2-(4-benzyl-2-chlorophenoxy)ethyl]carbamate |
|---|---|
| PubChem CID | 54506520 |
| Molecular Formula | C21H22ClNO3 |
| Molecular Weight | 371.86 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 2-methylbut-3-yn-2-yl N-[2-(4-benzyl-2-chlorophenoxy)ethyl]carbamate |
| SMILES | C#CC(C)(C)OC(=O)NCCOc1ccc(Cc2ccccc2)cc1Cl |
| InChI | InChI=1S/C21H22ClNO3/c1-4-21(2,3)26-20(24)23-12-13-25-19-11-10-17(15-18(19)22)14-16-8-6-5-7-9-16/h1,5-11,15H,12-14H2,2-3H3,(H,23,24) |
| InChIKey | YGCCBWNKAZWLMN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.86 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|