C20H19Cl2NO4 — CID 18966722
2-methylbut-3-yn-2-yl N-[2-[2-chloro-4-(3-chlorophenoxy)phenoxy]ethyl]carbamate (PubChem CID 18966722) has the molecular formula C20H19Cl2NO4 and a molecular weight of 408.28 g/mol. Its IUPAC name is 2-methylbut-3-yn-2-yl N-[2-[2-chloro-4-(3-chlorophenoxy)phenoxy]ethyl]carbamate.
| Compound Name | 2-methylbut-3-yn-2-yl N-[2-[2-chloro-4-(3-chlorophenoxy)phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 18966722 |
| Molecular Formula | C20H19Cl2NO4 |
| Molecular Weight | 408.28 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 2-methylbut-3-yn-2-yl N-[2-[2-chloro-4-(3-chlorophenoxy)phenoxy]ethyl]carbamate |
| SMILES | C#CC(C)(C)OC(=O)NCCOc1ccc(Oc2cccc(Cl)c2)cc1Cl |
| InChI | InChI=1S/C20H19Cl2NO4/c1-4-20(2,3)27-19(24)23-10-11-25-18-9-8-16(13-17(18)22)26-15-7-5-6-14(21)12-15/h1,5-9,12-13H,10-11H2,2-3H3,(H,23,24) |
| InChIKey | CQKWRPIOXDLQLZ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.28 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|