C19H20ClF2NO5 — CID 18966639
1-ethoxyethyl N-[2-[2-chloro-4-(3,5-difluorophenoxy)phenoxy]ethyl]carbamate (PubChem CID 18966639) has the molecular formula C19H20ClF2NO5 and a molecular weight of 415.82 g/mol. Its IUPAC name is 1-ethoxyethyl N-[2-[2-chloro-4-(3,5-difluorophenoxy)phenoxy]ethyl]carbamate.
| Compound Name | 1-ethoxyethyl N-[2-[2-chloro-4-(3,5-difluorophenoxy)phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 18966639 |
| Molecular Formula | C19H20ClF2NO5 |
| Molecular Weight | 415.82 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 1-ethoxyethyl N-[2-[2-chloro-4-(3,5-difluorophenoxy)phenoxy]ethyl]carbamate |
| SMILES | CCOC(C)OC(=O)NCCOc1ccc(Oc2cc(F)cc(F)c2)cc1Cl |
| InChI | InChI=1S/C19H20ClF2NO5/c1-3-25-12(2)27-19(24)23-6-7-26-18-5-4-15(11-17(18)20)28-16-9-13(21)8-14(22)10-16/h4-5,8-12H,3,6-7H2,1-2H3,(H,23,24) |
| InChIKey | BCASCPWVFIQHSC-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.82 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|