C17H16BrCl2NO4 — CID 18966710
2-bromoethyl N-[2-[2-chloro-4-(3-chlorophenoxy)phenoxy]ethyl]carbamate (PubChem CID 18966710) has the molecular formula C17H16BrCl2NO4 and a molecular weight of 449.13 g/mol. Its IUPAC name is 2-bromoethyl N-[2-[2-chloro-4-(3-chlorophenoxy)phenoxy]ethyl]carbamate.
| Compound Name | 2-bromoethyl N-[2-[2-chloro-4-(3-chlorophenoxy)phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 18966710 |
| Molecular Formula | C17H16BrCl2NO4 |
| Molecular Weight | 449.13 g/mol |
| Exact Mass | 446.96 |
| IUPAC Name | 2-bromoethyl N-[2-[2-chloro-4-(3-chlorophenoxy)phenoxy]ethyl]carbamate |
| SMILES | O=C(NCCOc1ccc(Oc2cccc(Cl)c2)cc1Cl)OCCBr |
| InChI | InChI=1S/C17H16BrCl2NO4/c18-6-8-24-17(22)21-7-9-23-16-5-4-14(11-15(16)20)25-13-3-1-2-12(19)10-13/h1-5,10-11H,6-9H2,(H,21,22) |
| InChIKey | MQAYQHYBFAANSW-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.13 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|