About [(E)-2-[2-chloro-4-(3-chlorophenoxy)phenoxy]ethenyl] N-ethylcarbamate
[(E)-2-[2-chloro-4-(3-chlorophenoxy)phenoxy]ethenyl] N-ethylcarbamate (PubChem CID 67848828) has the molecular formula C17H15Cl2NO4
and a molecular weight of 368.22 g/mol. Its IUPAC name is [(E)-2-[2-chloro-4-(3-chlorophenoxy)phenoxy]ethenyl] N-ethylcarbamate.
Molecular Properties
| Compound Name | [(E)-2-[2-chloro-4-(3-chlorophenoxy)phenoxy]ethenyl] N-ethylcarbamate |
| PubChem CID | 67848828 |
| Molecular Formula | C17H15Cl2NO4 |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | [(E)-2-[2-chloro-4-(3-chlorophenoxy)phenoxy]ethenyl] N-ethylcarbamate |
| SMILES | CCNC(=O)O/C=C/Oc1ccc(Oc2cccc(Cl)c2)cc1Cl |
| InChI | InChI=1S/C17H15Cl2NO4/c1-2-20-17(21)23-9-8-22-16-7-6-14(11-15(16)19)24-13-5-3-4-12(18)10-13/h3-11H,2H2,1H3,(H,20,21)/b9-8+ |
| InChIKey | UXNMHKZDQUBEBS-CMDGGOBGSA-N |
| XLogP | 5.38 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze [(E)-2-[2-chloro-4-(3-chlorophenoxy)phenoxy]ethenyl] N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-2-[2-chloro-4-(3-chlorophenoxy)phenoxy]ethenyl] N-ethylcarbamate?
The IUPAC name of [(E)-2-[2-chloro-4-(3-chlorophenoxy)phenoxy]ethenyl] N-ethylcarbamate (CID 67848828) is [(E)-2-[2-chloro-4-(3-chlorophenoxy)phenoxy]ethenyl] N-ethylcarbamate.
What is the SMILES notation for [(E)-2-[2-chloro-4-(3-chlorophenoxy)phenoxy]ethenyl] N-ethylcarbamate?
The canonical SMILES for [(E)-2-[2-chloro-4-(3-chlorophenoxy)phenoxy]ethenyl] N-ethylcarbamate is CCNC(=O)O/C=C/Oc1ccc(Oc2cccc(Cl)c2)cc1Cl.
What is the InChIKey of [(E)-2-[2-chloro-4-(3-chlorophenoxy)phenoxy]ethenyl] N-ethylcarbamate?
The InChIKey is UXNMHKZDQUBEBS-CMDGGOBGSA-N. The full InChI is InChI=1S/C17H15Cl2NO4/c1-2-20-17(21)23-9-8-22-16-7-6-14(11-15(16)19)24-13-5-3-4-12(18)10-13/h3-11H,2H2,1H3,(H,20,21)/b9-8+.
What are the key properties of [(E)-2-[2-chloro-4-(3-chlorophenoxy)phenoxy]ethenyl] N-ethylcarbamate?
[(E)-2-[2-chloro-4-(3-chlorophenoxy)phenoxy]ethenyl] N-ethylcarbamate has a molecular weight of 368.22 g/mol, XLogP of 5.38, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-2-[2-chloro-4-(3-chlorophenoxy)phenoxy]ethenyl] N-ethylcarbamate is sourced from PubChem (CID 67848828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).