C19H17Cl2NO4 — CID 54420868
but-3-yn-2-yl N-[2-[2-chloro-4-(3-chlorophenoxy)phenoxy]ethyl]carbamate (PubChem CID 54420868) has the molecular formula C19H17Cl2NO4 and a molecular weight of 394.25 g/mol. Its IUPAC name is but-3-yn-2-yl N-[2-[2-chloro-4-(3-chlorophenoxy)phenoxy]ethyl]carbamate.
| Compound Name | but-3-yn-2-yl N-[2-[2-chloro-4-(3-chlorophenoxy)phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 54420868 |
| Molecular Formula | C19H17Cl2NO4 |
| Molecular Weight | 394.25 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | but-3-yn-2-yl N-[2-[2-chloro-4-(3-chlorophenoxy)phenoxy]ethyl]carbamate |
| SMILES | C#CC(C)OC(=O)NCCOc1ccc(Oc2cccc(Cl)c2)cc1Cl |
| InChI | InChI=1S/C19H17Cl2NO4/c1-3-13(2)25-19(23)22-9-10-24-18-8-7-16(12-17(18)21)26-15-6-4-5-14(20)11-15/h1,4-8,11-13H,9-10H2,2H3,(H,22,23) |
| InChIKey | WARYNQPBLIJNFK-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.25 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|