C17H15Cl2F2NO4 — CID 18966667
2-chloroethyl N-[2-[2-chloro-4-(3,5-difluorophenoxy)phenoxy]ethyl]carbamate (PubChem CID 18966667) has the molecular formula C17H15Cl2F2NO4 and a molecular weight of 406.21 g/mol. Its IUPAC name is 2-chloroethyl N-[2-[2-chloro-4-(3,5-difluorophenoxy)phenoxy]ethyl]carbamate.
| Compound Name | 2-chloroethyl N-[2-[2-chloro-4-(3,5-difluorophenoxy)phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 18966667 |
| Molecular Formula | C17H15Cl2F2NO4 |
| Molecular Weight | 406.21 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | 2-chloroethyl N-[2-[2-chloro-4-(3,5-difluorophenoxy)phenoxy]ethyl]carbamate |
| SMILES | O=C(NCCOc1ccc(Oc2cc(F)cc(F)c2)cc1Cl)OCCCl |
| InChI | InChI=1S/C17H15Cl2F2NO4/c18-3-5-25-17(23)22-4-6-24-16-2-1-13(10-15(16)19)26-14-8-11(20)7-12(21)9-14/h1-2,7-10H,3-6H2,(H,22,23) |
| InChIKey | GRTJHWRBKDVQIL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.21 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|