C18H17BrClF2NO4 — CID 54139372
1-bromopropan-2-yl N-[2-[2-chloro-4-(3,5-difluorophenoxy)phenoxy]ethyl]carbamate (PubChem CID 54139372) has the molecular formula C18H17BrClF2NO4 and a molecular weight of 464.69 g/mol. Its IUPAC name is 1-bromopropan-2-yl N-[2-[2-chloro-4-(3,5-difluorophenoxy)phenoxy]ethyl]carbamate.
| Compound Name | 1-bromopropan-2-yl N-[2-[2-chloro-4-(3,5-difluorophenoxy)phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 54139372 |
| Molecular Formula | C18H17BrClF2NO4 |
| Molecular Weight | 464.69 g/mol |
| Exact Mass | 463.00 |
| IUPAC Name | 1-bromopropan-2-yl N-[2-[2-chloro-4-(3,5-difluorophenoxy)phenoxy]ethyl]carbamate |
| SMILES | CC(CBr)OC(=O)NCCOc1ccc(Oc2cc(F)cc(F)c2)cc1Cl |
| InChI | InChI=1S/C18H17BrClF2NO4/c1-11(10-19)26-18(24)23-4-5-25-17-3-2-14(9-16(17)20)27-15-7-12(21)6-13(22)8-15/h2-3,6-9,11H,4-5,10H2,1H3,(H,23,24) |
| InChIKey | NZZSUNYWWRLSPY-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.69 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|