C19H21Cl2NO4 — CID 54238460
butan-2-yl N-[2-[2-chloro-4-(3-chlorophenoxy)phenoxy]ethyl]carbamate (PubChem CID 54238460) has the molecular formula C19H21Cl2NO4 and a molecular weight of 398.29 g/mol. Its IUPAC name is butan-2-yl N-[2-[2-chloro-4-(3-chlorophenoxy)phenoxy]ethyl]carbamate.
| Compound Name | butan-2-yl N-[2-[2-chloro-4-(3-chlorophenoxy)phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 54238460 |
| Molecular Formula | C19H21Cl2NO4 |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | butan-2-yl N-[2-[2-chloro-4-(3-chlorophenoxy)phenoxy]ethyl]carbamate |
| SMILES | CCC(C)OC(=O)NCCOc1ccc(Oc2cccc(Cl)c2)cc1Cl |
| InChI | InChI=1S/C19H21Cl2NO4/c1-3-13(2)25-19(23)22-9-10-24-18-8-7-16(12-17(18)21)26-15-6-4-5-14(20)11-15/h4-8,11-13H,3,9-10H2,1-2H3,(H,22,23) |
| InChIKey | QOGJAKOFIVENLT-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|