C15H12ClF2NO4 — CID 57257814
2-[2-chloro-4-(3,5-difluorophenoxy)phenoxy]ethylcarbamic acid (PubChem CID 57257814) has the molecular formula C15H12ClF2NO4 and a molecular weight of 343.71 g/mol. Its IUPAC name is 2-[2-chloro-4-(3,5-difluorophenoxy)phenoxy]ethylcarbamic acid.
| Compound Name | 2-[2-chloro-4-(3,5-difluorophenoxy)phenoxy]ethylcarbamic acid |
|---|---|
| PubChem CID | 57257814 |
| Molecular Formula | C15H12ClF2NO4 |
| Molecular Weight | 343.71 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | 2-[2-chloro-4-(3,5-difluorophenoxy)phenoxy]ethylcarbamic acid |
| SMILES | O=C(O)NCCOc1ccc(Oc2cc(F)cc(F)c2)cc1Cl |
| InChI | InChI=1S/C15H12ClF2NO4/c16-13-8-11(23-12-6-9(17)5-10(18)7-12)1-2-14(13)22-4-3-19-15(20)21/h1-2,5-8,19H,3-4H2,(H,20,21) |
| InChIKey | KUCZOUZNNZCYRK-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.71 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|