C18H18ClF2NO3 — CID 173358911
4-[2-chloro-4-(3,5-difluorophenoxy)phenoxy]-N-ethoxybutan-1-imine (PubChem CID 173358911) has the molecular formula C18H18ClF2NO3 and a molecular weight of 369.80 g/mol. Its IUPAC name is 4-[2-chloro-4-(3,5-difluorophenoxy)phenoxy]-N-ethoxybutan-1-imine.
| Compound Name | 4-[2-chloro-4-(3,5-difluorophenoxy)phenoxy]-N-ethoxybutan-1-imine |
|---|---|
| PubChem CID | 173358911 |
| Molecular Formula | C18H18ClF2NO3 |
| Molecular Weight | 369.80 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 4-[2-chloro-4-(3,5-difluorophenoxy)phenoxy]-N-ethoxybutan-1-imine |
| SMILES | CCON=CCCCOc1ccc(Oc2cc(F)cc(F)c2)cc1Cl |
| InChI | InChI=1S/C18H18ClF2NO3/c1-2-24-22-7-3-4-8-23-18-6-5-15(12-17(18)19)25-16-10-13(20)9-14(21)11-16/h5-7,9-12H,2-4,8H2,1H3 |
| InChIKey | VYBBZLCRKUALSK-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.80 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|