C17H13ClF5NO4 — CID 18966686
2,2,2-trifluoroethyl N-[2-[2-chloro-4-(3,5-difluorophenoxy)phenoxy]ethyl]carbamate (PubChem CID 18966686) has the molecular formula C17H13ClF5NO4 and a molecular weight of 425.74 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[2-[2-chloro-4-(3,5-difluorophenoxy)phenoxy]ethyl]carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-[2-[2-chloro-4-(3,5-difluorophenoxy)phenoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 18966686 |
| Molecular Formula | C17H13ClF5NO4 |
| Molecular Weight | 425.74 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[2-[2-chloro-4-(3,5-difluorophenoxy)phenoxy]ethyl]carbamate |
| SMILES | O=C(NCCOc1ccc(Oc2cc(F)cc(F)c2)cc1Cl)OCC(F)(F)F |
| InChI | InChI=1S/C17H13ClF5NO4/c18-14-8-12(28-13-6-10(19)5-11(20)7-13)1-2-15(14)26-4-3-24-16(25)27-9-17(21,22)23/h1-2,5-8H,3-4,9H2,(H,24,25) |
| InChIKey | MQKAGLQLNGCYMS-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.74 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|