C14H13NO6S — CID 18966880
2-[(6-methoxycarbonyl-1,3-benzothiazol-2-yl)methyl]butanedioic acid (PubChem CID 18966880) has the molecular formula C14H13NO6S and a molecular weight of 323.33 g/mol. Its IUPAC name is 2-[(6-methoxycarbonyl-1,3-benzothiazol-2-yl)methyl]butanedioic acid.
| Compound Name | 2-[(6-methoxycarbonyl-1,3-benzothiazol-2-yl)methyl]butanedioic acid |
|---|---|
| PubChem CID | 18966880 |
| Molecular Formula | C14H13NO6S |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 2-[(6-methoxycarbonyl-1,3-benzothiazol-2-yl)methyl]butanedioic acid |
| SMILES | COC(=O)c1ccc2nc(CC(CC(=O)O)C(=O)O)sc2c1 |
| InChI | InChI=1S/C14H13NO6S/c1-21-14(20)7-2-3-9-10(4-7)22-11(15-9)5-8(13(18)19)6-12(16)17/h2-4,8H,5-6H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | NVTZUEMZRKUATH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 113.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |