C20H15N5O2S — CID 18973426
(5Z)-5-[[1-(2-azido-2-phenylethyl)indol-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 18973426) has the molecular formula C20H15N5O2S and a molecular weight of 389.44 g/mol. Its IUPAC name is (5Z)-5-[[1-(2-azido-2-phenylethyl)indol-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[1-(2-azido-2-phenylethyl)indol-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 18973426 |
| Molecular Formula | C20H15N5O2S |
| Molecular Weight | 389.44 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | (5Z)-5-[[1-(2-azido-2-phenylethyl)indol-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | [N-]=[N+]=NC(Cn1ccc2c(/C=C3\SC(=O)NC3=O)cccc21)c1ccccc1 |
| InChI | InChI=1S/C20H15N5O2S/c21-24-23-16(13-5-2-1-3-6-13)12-25-10-9-15-14(7-4-8-17(15)25)11-18-19(26)22-20(27)28-18/h1-11,16H,12H2,(H,22,26,27)/b18-11- |
| InChIKey | LCUINQYZZAXALA-WQRHYEAKSA-N |
| XLogP | 5.02 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.44 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|