C27H22N2O3S — CID 18973288
(5Z)-5-[[1-(2-phenyl-2-phenylmethoxyethyl)indol-4-yl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 18973288) has the molecular formula C27H22N2O3S and a molecular weight of 454.55 g/mol. Its IUPAC name is (5Z)-5-[[1-(2-phenyl-2-phenylmethoxyethyl)indol-4-yl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[1-(2-phenyl-2-phenylmethoxyethyl)indol-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 18973288 |
| Molecular Formula | C27H22N2O3S |
| Molecular Weight | 454.55 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | (5Z)-5-[[1-(2-phenyl-2-phenylmethoxyethyl)indol-4-yl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2cccc3c2ccn3CC(OCc2ccccc2)c2ccccc2)S1 |
| InChI | InChI=1S/C27H22N2O3S/c30-26-25(33-27(31)28-26)16-21-12-7-13-23-22(21)14-15-29(23)17-24(20-10-5-2-6-11-20)32-18-19-8-3-1-4-9-19/h1-16,24H,17-18H2,(H,28,30,31)/b25-16- |
| InChIKey | RCXLTQXEBHUVKL-XYGWBWBKSA-N |
| XLogP | 5.92 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.55 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|