C39H41F5O2S — CID 18976474
1-[5-(4,4,5,5,5-pentafluoropentylsulfanyl)pentoxy]-4-[(E)-2-phenyl-1-(4-phenylmethoxyphenyl)but-1-enyl]benzene (PubChem CID 18976474) has the molecular formula C39H41F5O2S and a molecular weight of 668.81 g/mol. Its IUPAC name is 1-[5-(4,4,5,5,5-pentafluoropentylsulfanyl)pentoxy]-4-[(E)-2-phenyl-1-(4-phenylmethoxyphenyl)but-1-enyl]benzene.
| Compound Name | 1-[5-(4,4,5,5,5-pentafluoropentylsulfanyl)pentoxy]-4-[(E)-2-phenyl-1-(4-phenylmethoxyphenyl)but-1-enyl]benzene |
|---|---|
| PubChem CID | 18976474 |
| Molecular Formula | C39H41F5O2S |
| Molecular Weight | 668.81 g/mol |
| Exact Mass | 668.27 |
| IUPAC Name | 1-[5-(4,4,5,5,5-pentafluoropentylsulfanyl)pentoxy]-4-[(E)-2-phenyl-1-(4-phenylmethoxyphenyl)but-1-enyl]benzene |
| SMILES | CC/C(=C(/c1ccc(OCCCCCSCCCC(F)(F)C(F)(F)F)cc1)c1ccc(OCc2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C39H41F5O2S/c1-2-36(31-15-8-4-9-16-31)37(33-19-23-35(24-20-33)46-29-30-13-6-3-7-14-30)32-17-21-34(22-18-32)45-26-10-5-11-27-47-28-12-25-38(40,41)39(42,43)44/h3-4,6-9,13-24H,2,5,10-12,25-29H2,1H3/b37-36+ |
| InChIKey | CHWMOWVZVBFUBL-BSRQYYOTSA-N |
| XLogP | 11.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.81 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|