About diethyl 2-iminobutanedioate
diethyl 2-iminobutanedioate (PubChem CID 18977200) has the molecular formula C8H13NO4
and a molecular weight of 187.19 g/mol. Its IUPAC name is diethyl 2-iminobutanedioate.
Molecular Properties
| Compound Name | diethyl 2-iminobutanedioate |
| PubChem CID | 18977200 |
| Molecular Formula | C8H13NO4 |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | diethyl 2-iminobutanedioate |
| SMILES | [H]/N=C(\CC(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C8H13NO4/c1-3-12-7(10)5-6(9)8(11)13-4-2/h9H,3-5H2,1-2H3/b9-6+ |
| InChIKey | IASLVYCHKIMROY-RMKNXTFCSA-N |
| XLogP | 0.52 |
| TPSA | 76.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-iminobutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-iminobutanedioate?
The IUPAC name of diethyl 2-iminobutanedioate (CID 18977200) is diethyl 2-iminobutanedioate.
What is the SMILES notation for diethyl 2-iminobutanedioate?
The canonical SMILES for diethyl 2-iminobutanedioate is [H]/N=C(\CC(=O)OCC)C(=O)OCC.
What is the InChIKey of diethyl 2-iminobutanedioate?
The InChIKey is IASLVYCHKIMROY-RMKNXTFCSA-N. The full InChI is InChI=1S/C8H13NO4/c1-3-12-7(10)5-6(9)8(11)13-4-2/h9H,3-5H2,1-2H3/b9-6+.
What are the key properties of diethyl 2-iminobutanedioate?
diethyl 2-iminobutanedioate has a molecular weight of 187.19 g/mol, XLogP of 0.52, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-iminobutanedioate is sourced from PubChem (CID 18977200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).