C13H28NO3PS — CID 18978140
N-(2-dihydroxyphosphinothioyloxyethyl)-N,5-dimethyl-2-propan-2-ylcyclohexan-1-amine (PubChem CID 18978140) has the molecular formula C13H28NO3PS and a molecular weight of 309.41 g/mol. Its IUPAC name is N-(2-dihydroxyphosphinothioyloxyethyl)-N,5-dimethyl-2-propan-2-ylcyclohexan-1-amine.
| Compound Name | N-(2-dihydroxyphosphinothioyloxyethyl)-N,5-dimethyl-2-propan-2-ylcyclohexan-1-amine |
|---|---|
| PubChem CID | 18978140 |
| Molecular Formula | C13H28NO3PS |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | N-(2-dihydroxyphosphinothioyloxyethyl)-N,5-dimethyl-2-propan-2-ylcyclohexan-1-amine |
| SMILES | CC1CCC(C(C)C)C(N(C)CCOP(O)(O)=S)C1 |
| InChI | InChI=1S/C13H28NO3PS/c1-10(2)12-6-5-11(3)9-13(12)14(4)7-8-17-18(15,16)19/h10-13H,5-9H2,1-4H3,(H2,15,16,19) |
| InChIKey | AUBKENMITHNUSV-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|