C14H30NO3PS — CID 57320646
2-[hydroxy-(5-methyl-2-propan-2-ylcyclohexyl)oxyphosphinothioyl]oxy-N,N-dimethylethanamine (PubChem CID 57320646) has the molecular formula C14H30NO3PS and a molecular weight of 323.44 g/mol. Its IUPAC name is 2-[hydroxy-(5-methyl-2-propan-2-ylcyclohexyl)oxyphosphinothioyl]oxy-N,N-dimethylethanamine.
| Compound Name | 2-[hydroxy-(5-methyl-2-propan-2-ylcyclohexyl)oxyphosphinothioyl]oxy-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 57320646 |
| Molecular Formula | C14H30NO3PS |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 2-[hydroxy-(5-methyl-2-propan-2-ylcyclohexyl)oxyphosphinothioyl]oxy-N,N-dimethylethanamine |
| SMILES | CC1CCC(C(C)C)C(OP(O)(=S)OCCN(C)C)C1 |
| InChI | InChI=1S/C14H30NO3PS/c1-11(2)13-7-6-12(3)10-14(13)18-19(16,20)17-9-8-15(4)5/h11-14H,6-10H2,1-5H3,(H,16,20) |
| InChIKey | UMPFBGIVKIDSHS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|