C22H41O3PS2 — CID 11190116
methyl bis[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy]phosphorylmethanedithioate (PubChem CID 11190116) has the molecular formula C22H41O3PS2 and a molecular weight of 448.68 g/mol. Its IUPAC name is methyl bis[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy]phosphorylmethanedithioate.
| Compound Name | methyl bis[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy]phosphorylmethanedithioate |
|---|---|
| PubChem CID | 11190116 |
| Molecular Formula | C22H41O3PS2 |
| Molecular Weight | 448.68 g/mol |
| Exact Mass | 448.22 |
| IUPAC Name | methyl bis[[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy]phosphorylmethanedithioate |
| SMILES | CSC(=S)P(=O)(O[C@@H]1C[C@H](C)CC[C@H]1C(C)C)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C22H41O3PS2/c1-14(2)18-10-8-16(5)12-20(18)24-26(23,22(27)28-7)25-21-13-17(6)9-11-19(21)15(3)4/h14-21H,8-13H2,1-7H3/t16-,17-,18+,19+,20-,21-/m1/s1 |
| InChIKey | KZTHQYWVUGDNLV-OKAKVDCISA-N |
| XLogP | 7.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.68 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|