C23H43O4P — CID 124667888
(2S)-2-[bis[[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy]phosphorylmethyl]oxirane (PubChem CID 124667888) has the molecular formula C23H43O4P and a molecular weight of 414.57 g/mol. Its IUPAC name is (2S)-2-[bis[[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy]phosphorylmethyl]oxirane.
| Compound Name | (2S)-2-[bis[[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy]phosphorylmethyl]oxirane |
|---|---|
| PubChem CID | 124667888 |
| Molecular Formula | C23H43O4P |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.29 |
| IUPAC Name | (2S)-2-[bis[[(1R,2R,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy]phosphorylmethyl]oxirane |
| SMILES | CC(C)[C@H]1CC[C@@H](C)C[C@H]1OP(=O)(C[C@@H]1CO1)O[C@@H]1C[C@H](C)CC[C@@H]1C(C)C |
| InChI | InChI=1S/C23H43O4P/c1-15(2)20-9-7-17(5)11-22(20)26-28(24,14-19-13-25-19)27-23-12-18(6)8-10-21(23)16(3)4/h15-23H,7-14H2,1-6H3/t17-,18-,19+,20-,21-,22-,23-/m1/s1 |
| InChIKey | DVVLSHWEHUZOIF-GATWQZFCSA-N |
| XLogP | 6.53 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|