C15H28NO2P — CID 102147072
N-[ethyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyphosphoryl]prop-2-yn-1-amine (PubChem CID 102147072) has the molecular formula C15H28NO2P and a molecular weight of 285.37 g/mol. Its IUPAC name is N-[ethyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyphosphoryl]prop-2-yn-1-amine.
| Compound Name | N-[ethyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyphosphoryl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 102147072 |
| Molecular Formula | C15H28NO2P |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | N-[ethyl-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxyphosphoryl]prop-2-yn-1-amine |
| SMILES | C#CCNP(=O)(CC)O[C@@H]1C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C15H28NO2P/c1-6-10-16-19(17,7-2)18-15-11-13(5)8-9-14(15)12(3)4/h1,12-15H,7-11H2,2-5H3,(H,16,17)/t13-,14+,15-,19?/m1/s1 |
| InChIKey | PXKVDQHWKQREQH-LZYSYQLFSA-N |
| XLogP | 3.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|