C11H23O3PS — CID 102070240
hydroxy-methoxy-(5-methyl-2-propan-2-ylcyclohexyl)oxy-sulfanylidene-λ5-phosphane (PubChem CID 102070240) has the molecular formula C11H23O3PS and a molecular weight of 266.34 g/mol. Its IUPAC name is hydroxy-methoxy-(5-methyl-2-propan-2-ylcyclohexyl)oxy-sulfanylidene-λ5-phosphane.
| Compound Name | hydroxy-methoxy-(5-methyl-2-propan-2-ylcyclohexyl)oxy-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 102070240 |
| Molecular Formula | C11H23O3PS |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | hydroxy-methoxy-(5-methyl-2-propan-2-ylcyclohexyl)oxy-sulfanylidene-λ5-phosphane |
| SMILES | COP(O)(=S)OC1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C11H23O3PS/c1-8(2)10-6-5-9(3)7-11(10)14-15(12,16)13-4/h8-11H,5-7H2,1-4H3,(H,12,16) |
| InChIKey | YRJZASMVRVKBTR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|