C42H40BNOS — CID 18982588
CID 18982588 (PubChem CID 18982588) has the molecular formula C42H40BNOS and a molecular weight of 617.67 g/mol.
| Compound Name | CID 18982588 |
|---|---|
| PubChem CID | 18982588 |
| Molecular Formula | C42H40BNOS |
| Molecular Weight | 617.67 g/mol |
| Exact Mass | 617.29 |
| IUPAC Name | — |
| SMILES | CCCC[B-](c1ccccc1)(c1ccccc1)c1ccccc1.N#Cc1ccc(C[S+](=O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H24B.C20H16NOS/c1-2-3-19-23(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22;21-15-17-11-13-18(14-12-17)16-23(22,19-7-3-1-4-8-19)20-9-5-2-6-10-20/h4-18H,2-3,19H2,1H3;1-14H,16H2/q-1;+1 |
| InChIKey | DLTUFWGKSJOALP-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.67 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|