C18H32O8 — CID 18986427
2-(2-methylprop-2-enoyloxy)ethyl 3,3-bis(tert-butylperoxy)butanoate (PubChem CID 18986427) has the molecular formula C18H32O8 and a molecular weight of 376.45 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)ethyl 3,3-bis(tert-butylperoxy)butanoate.
| Compound Name | 2-(2-methylprop-2-enoyloxy)ethyl 3,3-bis(tert-butylperoxy)butanoate |
|---|---|
| PubChem CID | 18986427 |
| Molecular Formula | C18H32O8 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)ethyl 3,3-bis(tert-butylperoxy)butanoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)CC(C)(OOC(C)(C)C)OOC(C)(C)C |
| InChI | InChI=1S/C18H32O8/c1-13(2)15(20)22-11-10-21-14(19)12-18(9,25-23-16(3,4)5)26-24-17(6,7)8/h1,10-12H2,2-9H3 |
| InChIKey | LVTFHCUNLNJIAO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|