C18H28O9 — CID 20643903
1-O-[3-(1-methoxy-2-methylpropan-2-yl)oxy-3-oxopropyl] 4-O-[2-(2-methylprop-2-enoyloxy)ethyl] butanedioate (PubChem CID 20643903) has the molecular formula C18H28O9 and a molecular weight of 388.41 g/mol. Its IUPAC name is 1-O-[3-(1-methoxy-2-methylpropan-2-yl)oxy-3-oxopropyl] 4-O-[2-(2-methylprop-2-enoyloxy)ethyl] butanedioate.
| Compound Name | 1-O-[3-(1-methoxy-2-methylpropan-2-yl)oxy-3-oxopropyl] 4-O-[2-(2-methylprop-2-enoyloxy)ethyl] butanedioate |
|---|---|
| PubChem CID | 20643903 |
| Molecular Formula | C18H28O9 |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 1-O-[3-(1-methoxy-2-methylpropan-2-yl)oxy-3-oxopropyl] 4-O-[2-(2-methylprop-2-enoyloxy)ethyl] butanedioate |
| SMILES | C=C(C)C(=O)OCCOC(=O)CCC(=O)OCCC(=O)OC(C)(C)COC |
| InChI | InChI=1S/C18H28O9/c1-13(2)17(22)26-11-10-25-15(20)7-6-14(19)24-9-8-16(21)27-18(3,4)12-23-5/h1,6-12H2,2-5H3 |
| InChIKey | BDWLQBOFWUWJPP-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|