C28H33N3O6 — CID 18986870
1-[2-[3-methoxy-2-(2-phenylethoxy)phenyl]ethyl]-4-pyridin-2-ylpiperazine;oxalic acid (PubChem CID 18986870) has the molecular formula C28H33N3O6 and a molecular weight of 507.59 g/mol. Its IUPAC name is 1-[2-[3-methoxy-2-(2-phenylethoxy)phenyl]ethyl]-4-pyridin-2-ylpiperazine;oxalic acid.
| Compound Name | 1-[2-[3-methoxy-2-(2-phenylethoxy)phenyl]ethyl]-4-pyridin-2-ylpiperazine;oxalic acid |
|---|---|
| PubChem CID | 18986870 |
| Molecular Formula | C28H33N3O6 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | 1-[2-[3-methoxy-2-(2-phenylethoxy)phenyl]ethyl]-4-pyridin-2-ylpiperazine;oxalic acid |
| SMILES | COc1cccc(CCN2CCN(c3ccccn3)CC2)c1OCCc1ccccc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C26H31N3O2.C2H2O4/c1-30-24-11-7-10-23(26(24)31-21-14-22-8-3-2-4-9-22)13-16-28-17-19-29(20-18-28)25-12-5-6-15-27-25;3-1(4)2(5)6/h2-12,15H,13-14,16-21H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | DQXBDVRJYPBDMV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|